C10H16ClNO2 — CID 10976907
(2S,3S)-3-chloro-2-methyl-1-morpholin-4-ylpent-4-en-1-one (PubChem CID 10976907) has the molecular formula C10H16ClNO2 and a molecular weight of 217.70 g/mol. Its IUPAC name is (2S,3S)-3-chloro-2-methyl-1-morpholin-4-ylpent-4-en-1-one.
| Compound Name | (2S,3S)-3-chloro-2-methyl-1-morpholin-4-ylpent-4-en-1-one |
|---|---|
| PubChem CID | 10976907 |
| Molecular Formula | C10H16ClNO2 |
| Molecular Weight | 217.70 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | (2S,3S)-3-chloro-2-methyl-1-morpholin-4-ylpent-4-en-1-one |
| SMILES | C=C[C@H](Cl)[C@@H](C)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C10H16ClNO2/c1-3-9(11)8(2)10(13)12-4-6-14-7-5-12/h3,8-9H,1,4-7H2,2H3/t8-,9+/m1/s1 |
| InChIKey | FOKYHGFOJAIYQQ-BDAKNGLRSA-N |
| XLogP | 1.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.70 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|