About S-ethyl 3-hydroxynonanethioate
S-ethyl 3-hydroxynonanethioate (PubChem CID 10976942) has the molecular formula C11H22O2S
and a molecular weight of 218.36 g/mol. Its IUPAC name is S-ethyl 3-hydroxynonanethioate.
Molecular Properties
| Compound Name | S-ethyl 3-hydroxynonanethioate |
| PubChem CID | 10976942 |
| Molecular Formula | C11H22O2S |
| Molecular Weight | 218.36 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | S-ethyl 3-hydroxynonanethioate |
| SMILES | CCCCCCC(O)CC(=O)SCC |
| InChI | InChI=1S/C11H22O2S/c1-3-5-6-7-8-10(12)9-11(13)14-4-2/h10,12H,3-9H2,1-2H3 |
| InChIKey | FPSHXNSFNIDKBF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-ethyl 3-hydroxynonanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethyl 3-hydroxynonanethioate?
The IUPAC name of S-ethyl 3-hydroxynonanethioate (CID 10976942) is S-ethyl 3-hydroxynonanethioate.
What is the SMILES notation for S-ethyl 3-hydroxynonanethioate?
The canonical SMILES for S-ethyl 3-hydroxynonanethioate is CCCCCCC(O)CC(=O)SCC.
What is the InChIKey of S-ethyl 3-hydroxynonanethioate?
The InChIKey is FPSHXNSFNIDKBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2S/c1-3-5-6-7-8-10(12)9-11(13)14-4-2/h10,12H,3-9H2,1-2H3.
What are the key properties of S-ethyl 3-hydroxynonanethioate?
S-ethyl 3-hydroxynonanethioate has a molecular weight of 218.36 g/mol, XLogP of 2.99, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethyl 3-hydroxynonanethioate is sourced from PubChem (CID 10976942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).