C10H14F4O — CID 10977170
[(Z)-2,3,3,3-tetrafluoro-1-methoxyprop-1-enyl]cyclohexane (PubChem CID 10977170) has the molecular formula C10H14F4O and a molecular weight of 226.21 g/mol. Its IUPAC name is [(Z)-2,3,3,3-tetrafluoro-1-methoxyprop-1-enyl]cyclohexane.
| Compound Name | [(Z)-2,3,3,3-tetrafluoro-1-methoxyprop-1-enyl]cyclohexane |
|---|---|
| PubChem CID | 10977170 |
| Molecular Formula | C10H14F4O |
| Molecular Weight | 226.21 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | [(Z)-2,3,3,3-tetrafluoro-1-methoxyprop-1-enyl]cyclohexane |
| SMILES | CO/C(=C(\F)C(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C10H14F4O/c1-15-8(9(11)10(12,13)14)7-5-3-2-4-6-7/h7H,2-6H2,1H3/b9-8- |
| InChIKey | DNMKYUDEGYQTEZ-HJWRWDBZSA-N |
| XLogP | 3.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.21 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|