8-prop-2-enyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid

C12H18O4 — CID 10977179

IUPAC8-prop-2-enyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid
SMILESC=CCC1(C(=O)O)CCC2(CC1)OCCO2
InChIInChI=1S/C12H18O4/c1-2-3-11(10(13)14)4-6-12(7-5-11)15-8-9-16-12/h2H,1,3-9H2,(H,13,14)
InChIKeyVHNHKTFZVXFICP-UHFFFAOYSA-N
MW226.27 g/mol
LogP1.95
Rot. Bonds3

About 8-prop-2-enyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid

8-prop-2-enyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid (PubChem CID 10977179) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 8-prop-2-enyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid.

Molecular Properties

Compound Name8-prop-2-enyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid
PubChem CID10977179
Molecular FormulaC12H18O4
Molecular Weight226.27 g/mol
Exact Mass226.12
IUPAC Name8-prop-2-enyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid
SMILESC=CCC1(C(=O)O)CCC2(CC1)OCCO2
InChIInChI=1S/C12H18O4/c1-2-3-11(10(13)14)4-6-12(7-5-11)15-8-9-16-12/h2H,1,3-9H2,(H,13,14)
InChIKeyVHNHKTFZVXFICP-UHFFFAOYSA-N
XLogP1.95
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.27
LogP ≤ 51.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 8-prop-2-enyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8-prop-2-enyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid?
The IUPAC name of 8-prop-2-enyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid (CID 10977179) is 8-prop-2-enyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid.
What is the SMILES notation for 8-prop-2-enyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid?
The canonical SMILES for 8-prop-2-enyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid is C=CCC1(C(=O)O)CCC2(CC1)OCCO2.
What is the InChIKey of 8-prop-2-enyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid?
The InChIKey is VHNHKTFZVXFICP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4/c1-2-3-11(10(13)14)4-6-12(7-5-11)15-8-9-16-12/h2H,1,3-9H2,(H,13,14).
What are the key properties of 8-prop-2-enyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid?
8-prop-2-enyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid has a molecular weight of 226.27 g/mol, XLogP of 1.95, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-prop-2-enyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid is sourced from PubChem (CID 10977179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).