C16H20O — CID 10977246
(3aS,9bS)-3a,8,9b-trimethyl-2,3,4,5-tetrahydrocyclopenta[a]naphthalen-1-one (PubChem CID 10977246) has the molecular formula C16H20O and a molecular weight of 228.33 g/mol. Its IUPAC name is (3aS,9bS)-3a,8,9b-trimethyl-2,3,4,5-tetrahydrocyclopenta[a]naphthalen-1-one.
| Compound Name | (3aS,9bS)-3a,8,9b-trimethyl-2,3,4,5-tetrahydrocyclopenta[a]naphthalen-1-one |
|---|---|
| PubChem CID | 10977246 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (3aS,9bS)-3a,8,9b-trimethyl-2,3,4,5-tetrahydrocyclopenta[a]naphthalen-1-one |
| SMILES | Cc1ccc2c(c1)[C@@]1(C)C(=O)CC[C@]1(C)CC2 |
| InChI | InChI=1S/C16H20O/c1-11-4-5-12-6-8-15(2)9-7-14(17)16(15,3)13(12)10-11/h4-5,10H,6-9H2,1-3H3/t15-,16-/m0/s1 |
| InChIKey | VVZKDWDSFMLRFW-HOTGVXAUSA-N |
| XLogP | 3.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |