About N-[2-(1,3-thiazole-2-carbonyl)phenyl]formamide
N-[2-(1,3-thiazole-2-carbonyl)phenyl]formamide (PubChem CID 10977329) has the molecular formula C11H8N2O2S
and a molecular weight of 232.26 g/mol. Its IUPAC name is N-[2-(1,3-thiazole-2-carbonyl)phenyl]formamide.
Molecular Properties
| Compound Name | N-[2-(1,3-thiazole-2-carbonyl)phenyl]formamide |
| PubChem CID | 10977329 |
| Molecular Formula | C11H8N2O2S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | N-[2-(1,3-thiazole-2-carbonyl)phenyl]formamide |
| SMILES | O=CNc1ccccc1C(=O)c1nccs1 |
| InChI | InChI=1S/C11H8N2O2S/c14-7-13-9-4-2-1-3-8(9)10(15)11-12-5-6-16-11/h1-7H,(H,13,14) |
| InChIKey | BNYPSOBOWCDICB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(1,3-thiazole-2-carbonyl)phenyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,3-thiazole-2-carbonyl)phenyl]formamide?
The IUPAC name of N-[2-(1,3-thiazole-2-carbonyl)phenyl]formamide (CID 10977329) is N-[2-(1,3-thiazole-2-carbonyl)phenyl]formamide.
What is the SMILES notation for N-[2-(1,3-thiazole-2-carbonyl)phenyl]formamide?
The canonical SMILES for N-[2-(1,3-thiazole-2-carbonyl)phenyl]formamide is O=CNc1ccccc1C(=O)c1nccs1.
What is the InChIKey of N-[2-(1,3-thiazole-2-carbonyl)phenyl]formamide?
The InChIKey is BNYPSOBOWCDICB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O2S/c14-7-13-9-4-2-1-3-8(9)10(15)11-12-5-6-16-11/h1-7H,(H,13,14).
What are the key properties of N-[2-(1,3-thiazole-2-carbonyl)phenyl]formamide?
N-[2-(1,3-thiazole-2-carbonyl)phenyl]formamide has a molecular weight of 232.26 g/mol, XLogP of 1.94, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,3-thiazole-2-carbonyl)phenyl]formamide is sourced from PubChem (CID 10977329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).