C13H15NO3 — CID 10977356
(4Z)-10-methoxy-4-methyl-1,2,3,6-tetrahydro-1-benzazocine-7,8-dione (PubChem CID 10977356) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is (4Z)-10-methoxy-4-methyl-1,2,3,6-tetrahydro-1-benzazocine-7,8-dione.
| Compound Name | (4Z)-10-methoxy-4-methyl-1,2,3,6-tetrahydro-1-benzazocine-7,8-dione |
|---|---|
| PubChem CID | 10977356 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | (4Z)-10-methoxy-4-methyl-1,2,3,6-tetrahydro-1-benzazocine-7,8-dione |
| SMILES | COC1=CC(=O)C(=O)C2=C1NCC/C(C)=C\C2 |
| InChI | InChI=1S/C13H15NO3/c1-8-3-4-9-12(14-6-5-8)11(17-2)7-10(15)13(9)16/h3,7,14H,4-6H2,1-2H3/b8-3- |
| InChIKey | MVQNEHPFORIUSK-BAQGIRSFSA-N |
| XLogP | 1.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|