About (2R)-3,3-bis(ethylsulfanyl)oxane-2-carbaldehyde
(2R)-3,3-bis(ethylsulfanyl)oxane-2-carbaldehyde (PubChem CID 10977393) has the molecular formula C10H18O2S2
and a molecular weight of 234.39 g/mol. Its IUPAC name is (2R)-3,3-bis(ethylsulfanyl)oxane-2-carbaldehyde.
Molecular Properties
| Compound Name | (2R)-3,3-bis(ethylsulfanyl)oxane-2-carbaldehyde |
| PubChem CID | 10977393 |
| Molecular Formula | C10H18O2S2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | (2R)-3,3-bis(ethylsulfanyl)oxane-2-carbaldehyde |
| SMILES | CCSC1(SCC)CCCO[C@@H]1C=O |
| InChI | InChI=1S/C10H18O2S2/c1-3-13-10(14-4-2)6-5-7-12-9(10)8-11/h8-9H,3-7H2,1-2H3/t9-/m1/s1 |
| InChIKey | VTDFZLHXHBUJDR-SECBINFHSA-N |
| XLogP | 2.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2R)-3,3-bis(ethylsulfanyl)oxane-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3,3-bis(ethylsulfanyl)oxane-2-carbaldehyde?
The IUPAC name of (2R)-3,3-bis(ethylsulfanyl)oxane-2-carbaldehyde (CID 10977393) is (2R)-3,3-bis(ethylsulfanyl)oxane-2-carbaldehyde.
What is the SMILES notation for (2R)-3,3-bis(ethylsulfanyl)oxane-2-carbaldehyde?
The canonical SMILES for (2R)-3,3-bis(ethylsulfanyl)oxane-2-carbaldehyde is CCSC1(SCC)CCCO[C@@H]1C=O.
What is the InChIKey of (2R)-3,3-bis(ethylsulfanyl)oxane-2-carbaldehyde?
The InChIKey is VTDFZLHXHBUJDR-SECBINFHSA-N. The full InChI is InChI=1S/C10H18O2S2/c1-3-13-10(14-4-2)6-5-7-12-9(10)8-11/h8-9H,3-7H2,1-2H3/t9-/m1/s1.
What are the key properties of (2R)-3,3-bis(ethylsulfanyl)oxane-2-carbaldehyde?
(2R)-3,3-bis(ethylsulfanyl)oxane-2-carbaldehyde has a molecular weight of 234.39 g/mol, XLogP of 2.57, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3,3-bis(ethylsulfanyl)oxane-2-carbaldehyde is sourced from PubChem (CID 10977393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).