About 9,10-dipropyl-9,11-diazabicyclo[6.2.1]undeca-1(10),8(11)-diene
9,10-dipropyl-9,11-diazabicyclo[6.2.1]undeca-1(10),8(11)-diene (PubChem CID 10977394) has the molecular formula C15H26N2
and a molecular weight of 234.39 g/mol. Its IUPAC name is 9,10-dipropyl-9,11-diazabicyclo[6.2.1]undeca-1(10),8(11)-diene.
Molecular Properties
| Compound Name | 9,10-dipropyl-9,11-diazabicyclo[6.2.1]undeca-1(10),8(11)-diene |
| PubChem CID | 10977394 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 9,10-dipropyl-9,11-diazabicyclo[6.2.1]undeca-1(10),8(11)-diene |
| SMILES | CCCc1c2nc(n1CCC)CCCCCC2 |
| InChI | InChI=1S/C15H26N2/c1-3-9-14-13-10-7-5-6-8-11-15(16-13)17(14)12-4-2/h3-12H2,1-2H3 |
| InChIKey | KWMIVSCTNSWIAT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9,10-dipropyl-9,11-diazabicyclo[6.2.1]undeca-1(10),8(11)-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-dipropyl-9,11-diazabicyclo[6.2.1]undeca-1(10),8(11)-diene?
The IUPAC name of 9,10-dipropyl-9,11-diazabicyclo[6.2.1]undeca-1(10),8(11)-diene (CID 10977394) is 9,10-dipropyl-9,11-diazabicyclo[6.2.1]undeca-1(10),8(11)-diene.
What is the SMILES notation for 9,10-dipropyl-9,11-diazabicyclo[6.2.1]undeca-1(10),8(11)-diene?
The canonical SMILES for 9,10-dipropyl-9,11-diazabicyclo[6.2.1]undeca-1(10),8(11)-diene is CCCc1c2nc(n1CCC)CCCCCC2.
What is the InChIKey of 9,10-dipropyl-9,11-diazabicyclo[6.2.1]undeca-1(10),8(11)-diene?
The InChIKey is KWMIVSCTNSWIAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2/c1-3-9-14-13-10-7-5-6-8-11-15(16-13)17(14)12-4-2/h3-12H2,1-2H3.
What are the key properties of 9,10-dipropyl-9,11-diazabicyclo[6.2.1]undeca-1(10),8(11)-diene?
9,10-dipropyl-9,11-diazabicyclo[6.2.1]undeca-1(10),8(11)-diene has a molecular weight of 234.39 g/mol, XLogP of 3.90, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-dipropyl-9,11-diazabicyclo[6.2.1]undeca-1(10),8(11)-diene is sourced from PubChem (CID 10977394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).