About 2-iodo-3-methoxypyrazine
2-iodo-3-methoxypyrazine (PubChem CID 10977417) has the molecular formula C5H5IN2O
and a molecular weight of 236.01 g/mol. Its IUPAC name is 2-iodo-3-methoxypyrazine.
Molecular Properties
| Compound Name | 2-iodo-3-methoxypyrazine |
| PubChem CID | 10977417 |
| Molecular Formula | C5H5IN2O |
| Molecular Weight | 236.01 g/mol |
| Exact Mass | 235.94 |
| IUPAC Name | 2-iodo-3-methoxypyrazine |
| SMILES | COc1nccnc1I |
| InChI | InChI=1S/C5H5IN2O/c1-9-5-4(6)7-2-3-8-5/h2-3H,1H3 |
| InChIKey | PDMRYBKGSOJHJJ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.01 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-3-methoxypyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-3-methoxypyrazine?
The IUPAC name of 2-iodo-3-methoxypyrazine (CID 10977417) is 2-iodo-3-methoxypyrazine.
What is the SMILES notation for 2-iodo-3-methoxypyrazine?
The canonical SMILES for 2-iodo-3-methoxypyrazine is COc1nccnc1I.
What is the InChIKey of 2-iodo-3-methoxypyrazine?
The InChIKey is PDMRYBKGSOJHJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5IN2O/c1-9-5-4(6)7-2-3-8-5/h2-3H,1H3.
What are the key properties of 2-iodo-3-methoxypyrazine?
2-iodo-3-methoxypyrazine has a molecular weight of 236.01 g/mol, XLogP of 1.09, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-3-methoxypyrazine is sourced from PubChem (CID 10977417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).