C14H20O3 — CID 10977441
methyl (4R)-4-hydroxy-4,8-dimethylspiro[4.5]deca-6,9-diene-8-carboxylate (PubChem CID 10977441) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is methyl (4R)-4-hydroxy-4,8-dimethylspiro[4.5]deca-6,9-diene-8-carboxylate.
| Compound Name | methyl (4R)-4-hydroxy-4,8-dimethylspiro[4.5]deca-6,9-diene-8-carboxylate |
|---|---|
| PubChem CID | 10977441 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | methyl (4R)-4-hydroxy-4,8-dimethylspiro[4.5]deca-6,9-diene-8-carboxylate |
| SMILES | COC(=O)C1(C)C=CC2(C=C1)CCC[C@@]2(C)O |
| InChI | InChI=1S/C14H20O3/c1-12(11(15)17-3)7-9-14(10-8-12)6-4-5-13(14,2)16/h7-10,16H,4-6H2,1-3H3/t12?,13-,14?/m1/s1 |
| InChIKey | KQKFPEKVYZMTNH-ROKHWSDSSA-N |
| XLogP | 2.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|