C17H18O — CID 10977504
6-methoxy-1-phenyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 10977504) has the molecular formula C17H18O and a molecular weight of 238.33 g/mol. Its IUPAC name is 6-methoxy-1-phenyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-methoxy-1-phenyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 10977504 |
| Molecular Formula | C17H18O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 6-methoxy-1-phenyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | COc1ccc2c(c1)CCCC2c1ccccc1 |
| InChI | InChI=1S/C17H18O/c1-18-15-10-11-17-14(12-15)8-5-9-16(17)13-6-3-2-4-7-13/h2-4,6-7,10-12,16H,5,8-9H2,1H3 |
| InChIKey | ZFOMLKXVQFNZPD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |