C7H8N6O2S — CID 10977551
5-(1,4-dimethyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 10977551) has the molecular formula C7H8N6O2S and a molecular weight of 240.25 g/mol. Its IUPAC name is 5-(1,4-dimethyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(1,4-dimethyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 10977551 |
| Molecular Formula | C7H8N6O2S |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 5-(1,4-dimethyl-5-nitroimidazol-2-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | Cc1nc(-c2nnc(N)s2)n(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H8N6O2S/c1-3-6(13(14)15)12(2)4(9-3)5-10-11-7(8)16-5/h1-2H3,(H2,8,11) |
| InChIKey | YGWYBFFYVFZABH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|