C9H5F6N — CID 10977588
1,1,1,3,3,3-hexafluoro-N-phenylpropan-2-imine (PubChem CID 10977588) has the molecular formula C9H5F6N and a molecular weight of 241.13 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-N-phenylpropan-2-imine.
| Compound Name | 1,1,1,3,3,3-hexafluoro-N-phenylpropan-2-imine |
|---|---|
| PubChem CID | 10977588 |
| Molecular Formula | C9H5F6N |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-N-phenylpropan-2-imine |
| SMILES | FC(F)(F)C(=Nc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C9H5F6N/c10-8(11,12)7(9(13,14)15)16-6-4-2-1-3-5-6/h1-5H |
| InChIKey | WAOPHCHEIBALCR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|