C26H16N2O6 — CID 1097763
2,6-bis(4-acetylphenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 1097763) has the molecular formula C26H16N2O6 and a molecular weight of 452.42 g/mol. Its IUPAC name is 2,6-bis(4-acetylphenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis(4-acetylphenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 1097763 |
| Molecular Formula | C26H16N2O6 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 2,6-bis(4-acetylphenyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | CC(=O)c1ccc(-n2c(=O)c3cc4c(=O)n(-c5ccc(C(C)=O)cc5)c(=O)c4cc3c2=O)cc1 |
| InChI | InChI=1S/C26H16N2O6/c1-13(29)15-3-7-17(8-4-15)27-23(31)19-11-21-22(12-20(19)24(27)32)26(34)28(25(21)33)18-9-5-16(6-10-18)14(2)30/h3-12H,1-2H3 |
| InChIKey | MLRWYYNPPHQUIS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 112.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |