C15H23NSi — CID 10977731
(E,E)-N-[tert-butyl(dimethyl)silyl]-3-phenylprop-2-en-1-imine (PubChem CID 10977731) has the molecular formula C15H23NSi and a molecular weight of 245.44 g/mol. Its IUPAC name is (E,E)-N-[tert-butyl(dimethyl)silyl]-3-phenylprop-2-en-1-imine.
| Compound Name | (E,E)-N-[tert-butyl(dimethyl)silyl]-3-phenylprop-2-en-1-imine |
|---|---|
| PubChem CID | 10977731 |
| Molecular Formula | C15H23NSi |
| Molecular Weight | 245.44 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | (E,E)-N-[tert-butyl(dimethyl)silyl]-3-phenylprop-2-en-1-imine |
| SMILES | CC(C)(C)[Si](C)(C)/N=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C15H23NSi/c1-15(2,3)17(4,5)16-13-9-12-14-10-7-6-8-11-14/h6-13H,1-5H3/b12-9+,16-13+ |
| InChIKey | JQQIMIHEFYFFSC-USJAFLQSSA-N |
| XLogP | 4.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|