About 2-phenylselanylpropanoyl chloride
2-phenylselanylpropanoyl chloride (PubChem CID 10977788) has the molecular formula C9H9ClOSe
and a molecular weight of 247.58 g/mol. Its IUPAC name is 2-phenylselanylpropanoyl chloride.
Molecular Properties
| Compound Name | 2-phenylselanylpropanoyl chloride |
| PubChem CID | 10977788 |
| Molecular Formula | C9H9ClOSe |
| Molecular Weight | 247.58 g/mol |
| Exact Mass | 247.95 |
| IUPAC Name | 2-phenylselanylpropanoyl chloride |
| SMILES | CC([Se]c1ccccc1)C(=O)Cl |
| InChI | InChI=1S/C9H9ClOSe/c1-7(9(10)11)12-8-5-3-2-4-6-8/h2-7H,1H3 |
| InChIKey | KXHDYBWEVGSPJA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.58 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylselanylpropanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylselanylpropanoyl chloride?
The IUPAC name of 2-phenylselanylpropanoyl chloride (CID 10977788) is 2-phenylselanylpropanoyl chloride.
What is the SMILES notation for 2-phenylselanylpropanoyl chloride?
The canonical SMILES for 2-phenylselanylpropanoyl chloride is CC([Se]c1ccccc1)C(=O)Cl.
What is the InChIKey of 2-phenylselanylpropanoyl chloride?
The InChIKey is KXHDYBWEVGSPJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClOSe/c1-7(9(10)11)12-8-5-3-2-4-6-8/h2-7H,1H3.
What are the key properties of 2-phenylselanylpropanoyl chloride?
2-phenylselanylpropanoyl chloride has a molecular weight of 247.58 g/mol, XLogP of 1.59, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylselanylpropanoyl chloride is sourced from PubChem (CID 10977788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).