C11H13F3O3 — CID 10977859
(2R,3S)-1,1,1-trifluoro-4-phenylmethoxybutane-2,3-diol (PubChem CID 10977859) has the molecular formula C11H13F3O3 and a molecular weight of 250.22 g/mol. Its IUPAC name is (2R,3S)-1,1,1-trifluoro-4-phenylmethoxybutane-2,3-diol.
| Compound Name | (2R,3S)-1,1,1-trifluoro-4-phenylmethoxybutane-2,3-diol |
|---|---|
| PubChem CID | 10977859 |
| Molecular Formula | C11H13F3O3 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (2R,3S)-1,1,1-trifluoro-4-phenylmethoxybutane-2,3-diol |
| SMILES | O[C@H]([C@@H](O)COCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H13F3O3/c12-11(13,14)10(16)9(15)7-17-6-8-4-2-1-3-5-8/h1-5,9-10,15-16H,6-7H2/t9-,10+/m0/s1 |
| InChIKey | NVSJFSAMFZXTFX-VHSXEESVSA-N |
| XLogP | 1.49 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |