About 5-[(2R,5R)-5-(phenylmethoxymethyl)oxolan-2-yl]-1H-imidazole
5-[(2R,5R)-5-(phenylmethoxymethyl)oxolan-2-yl]-1H-imidazole (PubChem CID 10978141) has the molecular formula C15H18N2O2
and a molecular weight of 258.32 g/mol. Its IUPAC name is 5-[(2R,5R)-5-(phenylmethoxymethyl)oxolan-2-yl]-1H-imidazole.
Molecular Properties
| Compound Name | 5-[(2R,5R)-5-(phenylmethoxymethyl)oxolan-2-yl]-1H-imidazole |
| PubChem CID | 10978141 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 5-[(2R,5R)-5-(phenylmethoxymethyl)oxolan-2-yl]-1H-imidazole |
| SMILES | c1ccc(COC[C@H]2CC[C@H](c3cnc[nH]3)O2)cc1 |
| InChI | InChI=1S/C15H18N2O2/c1-2-4-12(5-3-1)9-18-10-13-6-7-15(19-13)14-8-16-11-17-14/h1-5,8,11,13,15H,6-7,9-10H2,(H,16,17)/t13-,15-/m1/s1 |
| InChIKey | RETVAMKTDRMQFH-UKRRQHHQSA-N |
| XLogP | 2.85 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(2R,5R)-5-(phenylmethoxymethyl)oxolan-2-yl]-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2R,5R)-5-(phenylmethoxymethyl)oxolan-2-yl]-1H-imidazole?
The IUPAC name of 5-[(2R,5R)-5-(phenylmethoxymethyl)oxolan-2-yl]-1H-imidazole (CID 10978141) is 5-[(2R,5R)-5-(phenylmethoxymethyl)oxolan-2-yl]-1H-imidazole.
What is the SMILES notation for 5-[(2R,5R)-5-(phenylmethoxymethyl)oxolan-2-yl]-1H-imidazole?
The canonical SMILES for 5-[(2R,5R)-5-(phenylmethoxymethyl)oxolan-2-yl]-1H-imidazole is c1ccc(COC[C@H]2CC[C@H](c3cnc[nH]3)O2)cc1.
What is the InChIKey of 5-[(2R,5R)-5-(phenylmethoxymethyl)oxolan-2-yl]-1H-imidazole?
The InChIKey is RETVAMKTDRMQFH-UKRRQHHQSA-N. The full InChI is InChI=1S/C15H18N2O2/c1-2-4-12(5-3-1)9-18-10-13-6-7-15(19-13)14-8-16-11-17-14/h1-5,8,11,13,15H,6-7,9-10H2,(H,16,17)/t13-,15-/m1/s1.
What are the key properties of 5-[(2R,5R)-5-(phenylmethoxymethyl)oxolan-2-yl]-1H-imidazole?
5-[(2R,5R)-5-(phenylmethoxymethyl)oxolan-2-yl]-1H-imidazole has a molecular weight of 258.32 g/mol, XLogP of 2.85, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2R,5R)-5-(phenylmethoxymethyl)oxolan-2-yl]-1H-imidazole is sourced from PubChem (CID 10978141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).