C12H16F2O2S — CID 10978274
(1S,4R)-2-(difluoromethyl)-3-propylsulfonylbicyclo[2.2.2]octa-2,5-diene (PubChem CID 10978274) has the molecular formula C12H16F2O2S and a molecular weight of 262.32 g/mol. Its IUPAC name is (1S,4R)-2-(difluoromethyl)-3-propylsulfonylbicyclo[2.2.2]octa-2,5-diene.
| Compound Name | (1S,4R)-2-(difluoromethyl)-3-propylsulfonylbicyclo[2.2.2]octa-2,5-diene |
|---|---|
| PubChem CID | 10978274 |
| Molecular Formula | C12H16F2O2S |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | (1S,4R)-2-(difluoromethyl)-3-propylsulfonylbicyclo[2.2.2]octa-2,5-diene |
| SMILES | CCCS(=O)(=O)C1=C(C(F)F)[C@@H]2C=C[C@H]1CC2 |
| InChI | InChI=1S/C12H16F2O2S/c1-2-7-17(15,16)11-9-5-3-8(4-6-9)10(11)12(13)14/h3,5,8-9,12H,2,4,6-7H2,1H3/t8-,9+/m1/s1 |
| InChIKey | AHXKAGARQWFVTL-BDAKNGLRSA-N |
| XLogP | 2.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|