C12H21NO4Si — CID 10978576
tert-butyl (3aR,6aR)-1,1-dimethyl-3-oxo-3a,5,6,6a-tetrahydrooxasilolo[4,3-b]pyrrole-4-carboxylate (PubChem CID 10978576) has the molecular formula C12H21NO4Si and a molecular weight of 271.39 g/mol. Its IUPAC name is tert-butyl (3aR,6aR)-1,1-dimethyl-3-oxo-3a,5,6,6a-tetrahydrooxasilolo[4,3-b]pyrrole-4-carboxylate.
| Compound Name | tert-butyl (3aR,6aR)-1,1-dimethyl-3-oxo-3a,5,6,6a-tetrahydrooxasilolo[4,3-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 10978576 |
| Molecular Formula | C12H21NO4Si |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | tert-butyl (3aR,6aR)-1,1-dimethyl-3-oxo-3a,5,6,6a-tetrahydrooxasilolo[4,3-b]pyrrole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]2[C@H]1C(=O)O[Si]2(C)C |
| InChI | InChI=1S/C12H21NO4Si/c1-12(2,3)16-11(15)13-7-6-8-9(13)10(14)17-18(8,4)5/h8-9H,6-7H2,1-5H3/t8-,9+/m1/s1 |
| InChIKey | ZXLLDDFXARYCNC-BDAKNGLRSA-N |
| XLogP | 2.13 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|