About N-[2-(3,4-dihydronaphthalen-2-yl)propan-2-yl]-1-phenylmethanimine
N-[2-(3,4-dihydronaphthalen-2-yl)propan-2-yl]-1-phenylmethanimine (PubChem CID 10978709) has the molecular formula C20H21N
and a molecular weight of 275.40 g/mol. Its IUPAC name is N-[2-(3,4-dihydronaphthalen-2-yl)propan-2-yl]-1-phenylmethanimine.
Molecular Properties
| Compound Name | N-[2-(3,4-dihydronaphthalen-2-yl)propan-2-yl]-1-phenylmethanimine |
| PubChem CID | 10978709 |
| Molecular Formula | C20H21N |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | N-[2-(3,4-dihydronaphthalen-2-yl)propan-2-yl]-1-phenylmethanimine |
| SMILES | CC(C)(/N=C/c1ccccc1)C1=Cc2ccccc2CC1 |
| InChI | InChI=1S/C20H21N/c1-20(2,21-15-16-8-4-3-5-9-16)19-13-12-17-10-6-7-11-18(17)14-19/h3-11,14-15H,12-13H2,1-2H3/b21-15+ |
| InChIKey | YWQGJOUIKVYCKA-RCCKNPSSSA-N |
| XLogP | 4.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3,4-dihydronaphthalen-2-yl)propan-2-yl]-1-phenylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,4-dihydronaphthalen-2-yl)propan-2-yl]-1-phenylmethanimine?
The IUPAC name of N-[2-(3,4-dihydronaphthalen-2-yl)propan-2-yl]-1-phenylmethanimine (CID 10978709) is N-[2-(3,4-dihydronaphthalen-2-yl)propan-2-yl]-1-phenylmethanimine.
What is the SMILES notation for N-[2-(3,4-dihydronaphthalen-2-yl)propan-2-yl]-1-phenylmethanimine?
The canonical SMILES for N-[2-(3,4-dihydronaphthalen-2-yl)propan-2-yl]-1-phenylmethanimine is CC(C)(/N=C/c1ccccc1)C1=Cc2ccccc2CC1.
What is the InChIKey of N-[2-(3,4-dihydronaphthalen-2-yl)propan-2-yl]-1-phenylmethanimine?
The InChIKey is YWQGJOUIKVYCKA-RCCKNPSSSA-N. The full InChI is InChI=1S/C20H21N/c1-20(2,21-15-16-8-4-3-5-9-16)19-13-12-17-10-6-7-11-18(17)14-19/h3-11,14-15H,12-13H2,1-2H3/b21-15+.
What are the key properties of N-[2-(3,4-dihydronaphthalen-2-yl)propan-2-yl]-1-phenylmethanimine?
N-[2-(3,4-dihydronaphthalen-2-yl)propan-2-yl]-1-phenylmethanimine has a molecular weight of 275.40 g/mol, XLogP of 4.91, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,4-dihydronaphthalen-2-yl)propan-2-yl]-1-phenylmethanimine is sourced from PubChem (CID 10978709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).