C13H24O2S2 — CID 10978743
(E,2R,4R)-1-(1,3-dithian-2-yl)-3,3-dimethylhept-5-ene-2,4-diol (PubChem CID 10978743) has the molecular formula C13H24O2S2 and a molecular weight of 276.47 g/mol. Its IUPAC name is (E,2R,4R)-1-(1,3-dithian-2-yl)-3,3-dimethylhept-5-ene-2,4-diol.
| Compound Name | (E,2R,4R)-1-(1,3-dithian-2-yl)-3,3-dimethylhept-5-ene-2,4-diol |
|---|---|
| PubChem CID | 10978743 |
| Molecular Formula | C13H24O2S2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (E,2R,4R)-1-(1,3-dithian-2-yl)-3,3-dimethylhept-5-ene-2,4-diol |
| SMILES | C/C=C/[C@@H](O)C(C)(C)[C@H](O)CC1SCCCS1 |
| InChI | InChI=1S/C13H24O2S2/c1-4-6-10(14)13(2,3)11(15)9-12-16-7-5-8-17-12/h4,6,10-12,14-15H,5,7-9H2,1-3H3/b6-4+/t10-,11-/m1/s1 |
| InChIKey | MVOMNINUPBEBGG-JYBZGJHDSA-N |
| XLogP | 2.90 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|