C14H32O3Si — CID 10978745
(2R,3R)-1-[tert-butyl(dimethyl)silyl]oxyoctane-2,3-diol (PubChem CID 10978745) has the molecular formula C14H32O3Si and a molecular weight of 276.49 g/mol. Its IUPAC name is (2R,3R)-1-[tert-butyl(dimethyl)silyl]oxyoctane-2,3-diol.
| Compound Name | (2R,3R)-1-[tert-butyl(dimethyl)silyl]oxyoctane-2,3-diol |
|---|---|
| PubChem CID | 10978745 |
| Molecular Formula | C14H32O3Si |
| Molecular Weight | 276.49 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | (2R,3R)-1-[tert-butyl(dimethyl)silyl]oxyoctane-2,3-diol |
| SMILES | CCCCC[C@@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H32O3Si/c1-7-8-9-10-12(15)13(16)11-17-18(5,6)14(2,3)4/h12-13,15-16H,7-11H2,1-6H3/t12-,13-/m1/s1 |
| InChIKey | JJWHQRDKTORFAU-CHWSQXEVSA-N |
| XLogP | 3.31 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|