C18H18O3 — CID 10978915
1-(4-hydroxy-2,3,5,6-tetramethylphenyl)-2-phenylethane-1,2-dione (PubChem CID 10978915) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 1-(4-hydroxy-2,3,5,6-tetramethylphenyl)-2-phenylethane-1,2-dione.
| Compound Name | 1-(4-hydroxy-2,3,5,6-tetramethylphenyl)-2-phenylethane-1,2-dione |
|---|---|
| PubChem CID | 10978915 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 1-(4-hydroxy-2,3,5,6-tetramethylphenyl)-2-phenylethane-1,2-dione |
| SMILES | Cc1c(C)c(C(=O)C(=O)c2ccccc2)c(C)c(C)c1O |
| InChI | InChI=1S/C18H18O3/c1-10-12(3)16(19)13(4)11(2)15(10)18(21)17(20)14-8-6-5-7-9-14/h5-9,19H,1-4H3 |
| InChIKey | GRQTWQFORYZHHF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|