C11H6F5NO3 — CID 10979324
(2S,3R)-5-oxo-3-(2,3,4,5,6-pentafluorophenyl)pyrrolidine-2-carboxylic acid (PubChem CID 10979324) has the molecular formula C11H6F5NO3 and a molecular weight of 295.16 g/mol. Its IUPAC name is (2S,3R)-5-oxo-3-(2,3,4,5,6-pentafluorophenyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3R)-5-oxo-3-(2,3,4,5,6-pentafluorophenyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 10979324 |
| Molecular Formula | C11H6F5NO3 |
| Molecular Weight | 295.16 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | (2S,3R)-5-oxo-3-(2,3,4,5,6-pentafluorophenyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C1C[C@H](c2c(F)c(F)c(F)c(F)c2F)[C@@H](C(=O)O)N1 |
| InChI | InChI=1S/C11H6F5NO3/c12-5-4(6(13)8(15)9(16)7(5)14)2-1-3(18)17-10(2)11(19)20/h2,10H,1H2,(H,17,18)(H,19,20)/t2-,10+/m1/s1 |
| InChIKey | CVAJNCKPXCFTEU-LRQHDJKPSA-N |
| XLogP | 1.44 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.16 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|