About icos-1-en-3-ol
icos-1-en-3-ol (PubChem CID 10979378) has the molecular formula C20H40O
and a molecular weight of 296.54 g/mol. Its IUPAC name is icos-1-en-3-ol.
Molecular Properties
| Compound Name | icos-1-en-3-ol |
| PubChem CID | 10979378 |
| Molecular Formula | C20H40O |
| Molecular Weight | 296.54 g/mol |
| Exact Mass | 296.31 |
| IUPAC Name | icos-1-en-3-ol |
| SMILES | C=CC(O)CCCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C20H40O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)4-2/h4,20-21H,2-3,5-19H2,1H3 |
| InChIKey | YDQHNOWGMPESTK-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.54 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze icos-1-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of icos-1-en-3-ol?
The IUPAC name of icos-1-en-3-ol (CID 10979378) is icos-1-en-3-ol.
What is the SMILES notation for icos-1-en-3-ol?
The canonical SMILES for icos-1-en-3-ol is C=CC(O)CCCCCCCCCCCCCCCCC.
What is the InChIKey of icos-1-en-3-ol?
The InChIKey is YDQHNOWGMPESTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)4-2/h4,20-21H,2-3,5-19H2,1H3.
What are the key properties of icos-1-en-3-ol?
icos-1-en-3-ol has a molecular weight of 296.54 g/mol, XLogP of 6.79, 17 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for icos-1-en-3-ol is sourced from PubChem (CID 10979378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).