C15H11ClF2O2 — CID 10979379
1-(4-chlorophenyl)-2,2-difluoro-3-hydroxy-3-phenylpropan-1-one (PubChem CID 10979379) has the molecular formula C15H11ClF2O2 and a molecular weight of 296.70 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,2-difluoro-3-hydroxy-3-phenylpropan-1-one.
| Compound Name | 1-(4-chlorophenyl)-2,2-difluoro-3-hydroxy-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 10979379 |
| Molecular Formula | C15H11ClF2O2 |
| Molecular Weight | 296.70 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 1-(4-chlorophenyl)-2,2-difluoro-3-hydroxy-3-phenylpropan-1-one |
| SMILES | O=C(c1ccc(Cl)cc1)C(F)(F)C(O)c1ccccc1 |
| InChI | InChI=1S/C15H11ClF2O2/c16-12-8-6-11(7-9-12)14(20)15(17,18)13(19)10-4-2-1-3-5-10/h1-9,13,19H |
| InChIKey | AGFJRXXSRSKGPH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.70 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |