C19H27NO2 — CID 10979542
(2S)-2-(methoxymethyl)-1-[(3E)-3-methyl-5-phenylmethoxypenta-1,3-dien-2-yl]pyrrolidine (PubChem CID 10979542) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is (2S)-2-(methoxymethyl)-1-[(3E)-3-methyl-5-phenylmethoxypenta-1,3-dien-2-yl]pyrrolidine.
| Compound Name | (2S)-2-(methoxymethyl)-1-[(3E)-3-methyl-5-phenylmethoxypenta-1,3-dien-2-yl]pyrrolidine |
|---|---|
| PubChem CID | 10979542 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | (2S)-2-(methoxymethyl)-1-[(3E)-3-methyl-5-phenylmethoxypenta-1,3-dien-2-yl]pyrrolidine |
| SMILES | C=C(/C(C)=C/COCc1ccccc1)N1CCC[C@H]1COC |
| InChI | InChI=1S/C19H27NO2/c1-16(11-13-22-14-18-8-5-4-6-9-18)17(2)20-12-7-10-19(20)15-21-3/h4-6,8-9,11,19H,2,7,10,12-15H2,1,3H3/b16-11+/t19-/m0/s1 |
| InChIKey | YKBRQIBAMCBFHU-SKTWIKFTSA-N |
| XLogP | 3.77 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|