C15H16N+ — CID 10979802
(4-cyclohepta-2,4,6-trien-1-ylidenecyclohexa-2,5-dien-1-ylidene)-dimethylazanium (PubChem CID 10979802) has the molecular formula C15H16N+ and a molecular weight of 210.30 g/mol. Its IUPAC name is (4-cyclohepta-2,4,6-trien-1-ylidenecyclohexa-2,5-dien-1-ylidene)-dimethylazanium.
| Compound Name | (4-cyclohepta-2,4,6-trien-1-ylidenecyclohexa-2,5-dien-1-ylidene)-dimethylazanium |
|---|---|
| PubChem CID | 10979802 |
| Molecular Formula | C15H16N+ |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (4-cyclohepta-2,4,6-trien-1-ylidenecyclohexa-2,5-dien-1-ylidene)-dimethylazanium |
| SMILES | C[N+](C)=C1C=CC(=C2C=CC=CC=C2)C=C1 |
| InChI | InChI=1S/C15H16N/c1-16(2)15-11-9-14(10-12-15)13-7-5-3-4-6-8-13/h3-12H,1-2H3/q+1 |
| InChIKey | XMVMYEIRIIRKOE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|