About methyl (E)-4-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]but-2-enoate
methyl (E)-4-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]but-2-enoate (PubChem CID 10979966) has the molecular formula C16H30O4Si
and a molecular weight of 314.50 g/mol. Its IUPAC name is methyl (E)-4-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]but-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-4-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]but-2-enoate |
| PubChem CID | 10979966 |
| Molecular Formula | C16H30O4Si |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | methyl (E)-4-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]but-2-enoate |
| SMILES | COC(=O)/C=C/C[C@H]1OCCC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H30O4Si/c1-16(2,3)21(5,6)20-14-10-8-12-19-13(14)9-7-11-15(17)18-4/h7,11,13-14H,8-10,12H2,1-6H3/b11-7+/t13-,14-/m1/s1 |
| InChIKey | OBWDWDQVFDYVKG-VAZNYKRKSA-N |
| XLogP | 3.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-4-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-4-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]but-2-enoate?
The IUPAC name of methyl (E)-4-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]but-2-enoate (CID 10979966) is methyl (E)-4-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]but-2-enoate.
What is the SMILES notation for methyl (E)-4-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]but-2-enoate?
The canonical SMILES for methyl (E)-4-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]but-2-enoate is COC(=O)/C=C/C[C@H]1OCCC[C@H]1O[Si](C)(C)C(C)(C)C.
What is the InChIKey of methyl (E)-4-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]but-2-enoate?
The InChIKey is OBWDWDQVFDYVKG-VAZNYKRKSA-N. The full InChI is InChI=1S/C16H30O4Si/c1-16(2,3)21(5,6)20-14-10-8-12-19-13(14)9-7-11-15(17)18-4/h7,11,13-14H,8-10,12H2,1-6H3/b11-7+/t13-,14-/m1/s1.
What are the key properties of methyl (E)-4-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]but-2-enoate?
methyl (E)-4-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]but-2-enoate has a molecular weight of 314.50 g/mol, XLogP of 3.68, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-4-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]but-2-enoate is sourced from PubChem (CID 10979966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).