About 2-benzyl-6-(3,4-dimethoxyphenyl)-4,5-dihydropyridazin-3-one
2-benzyl-6-(3,4-dimethoxyphenyl)-4,5-dihydropyridazin-3-one (PubChem CID 10980260) has the molecular formula C19H20N2O3
and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-benzyl-6-(3,4-dimethoxyphenyl)-4,5-dihydropyridazin-3-one.
Molecular Properties
| Compound Name | 2-benzyl-6-(3,4-dimethoxyphenyl)-4,5-dihydropyridazin-3-one |
| PubChem CID | 10980260 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 2-benzyl-6-(3,4-dimethoxyphenyl)-4,5-dihydropyridazin-3-one |
| SMILES | COc1ccc(C2=NN(Cc3ccccc3)C(=O)CC2)cc1OC |
| InChI | InChI=1S/C19H20N2O3/c1-23-17-10-8-15(12-18(17)24-2)16-9-11-19(22)21(20-16)13-14-6-4-3-5-7-14/h3-8,10,12H,9,11,13H2,1-2H3 |
| InChIKey | OSGFQUPLDZBTPO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-benzyl-6-(3,4-dimethoxyphenyl)-4,5-dihydropyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-6-(3,4-dimethoxyphenyl)-4,5-dihydropyridazin-3-one?
The IUPAC name of 2-benzyl-6-(3,4-dimethoxyphenyl)-4,5-dihydropyridazin-3-one (CID 10980260) is 2-benzyl-6-(3,4-dimethoxyphenyl)-4,5-dihydropyridazin-3-one.
What is the SMILES notation for 2-benzyl-6-(3,4-dimethoxyphenyl)-4,5-dihydropyridazin-3-one?
The canonical SMILES for 2-benzyl-6-(3,4-dimethoxyphenyl)-4,5-dihydropyridazin-3-one is COc1ccc(C2=NN(Cc3ccccc3)C(=O)CC2)cc1OC.
What is the InChIKey of 2-benzyl-6-(3,4-dimethoxyphenyl)-4,5-dihydropyridazin-3-one?
The InChIKey is OSGFQUPLDZBTPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O3/c1-23-17-10-8-15(12-18(17)24-2)16-9-11-19(22)21(20-16)13-14-6-4-3-5-7-14/h3-8,10,12H,9,11,13H2,1-2H3.
What are the key properties of 2-benzyl-6-(3,4-dimethoxyphenyl)-4,5-dihydropyridazin-3-one?
2-benzyl-6-(3,4-dimethoxyphenyl)-4,5-dihydropyridazin-3-one has a molecular weight of 324.38 g/mol, XLogP of 3.23, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-6-(3,4-dimethoxyphenyl)-4,5-dihydropyridazin-3-one is sourced from PubChem (CID 10980260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).