About rhodium;bis(2,2,2-trifluoroacetic acid)
rhodium;bis(2,2,2-trifluoroacetic acid) (PubChem CID 10980383) has the molecular formula C4H2F6O4Rh
and a molecular weight of 330.95 g/mol. Its IUPAC name is rhodium;bis(2,2,2-trifluoroacetic acid).
Molecular Properties
| Compound Name | rhodium;bis(2,2,2-trifluoroacetic acid) |
| PubChem CID | 10980383 |
| Molecular Formula | C4H2F6O4Rh |
| Molecular Weight | 330.95 g/mol |
| Exact Mass | 330.89 |
| IUPAC Name | rhodium;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[Rh] |
| InChI | InChI=1S/2C2HF3O2.Rh/c2*3-2(4,5)1(6)7;/h2*(H,6,7); |
| InChIKey | CLEOSONSBHBBRR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.95 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze rhodium;bis(2,2,2-trifluoroacetic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of rhodium;bis(2,2,2-trifluoroacetic acid)?
The IUPAC name of rhodium;bis(2,2,2-trifluoroacetic acid) (CID 10980383) is rhodium;bis(2,2,2-trifluoroacetic acid).
What is the SMILES notation for rhodium;bis(2,2,2-trifluoroacetic acid)?
The canonical SMILES for rhodium;bis(2,2,2-trifluoroacetic acid) is O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[Rh].
What is the InChIKey of rhodium;bis(2,2,2-trifluoroacetic acid)?
The InChIKey is CLEOSONSBHBBRR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C2HF3O2.Rh/c2*3-2(4,5)1(6)7;/h2*(H,6,7);.
What are the key properties of rhodium;bis(2,2,2-trifluoroacetic acid)?
rhodium;bis(2,2,2-trifluoroacetic acid) has a molecular weight of 330.95 g/mol, XLogP of 1.26, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for rhodium;bis(2,2,2-trifluoroacetic acid) is sourced from PubChem (CID 10980383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).