About 4-trityliminobutan-1-ol
4-trityliminobutan-1-ol (PubChem CID 10980398) has the molecular formula C23H23NO
and a molecular weight of 329.44 g/mol. Its IUPAC name is 4-trityliminobutan-1-ol.
Molecular Properties
| Compound Name | 4-trityliminobutan-1-ol |
| PubChem CID | 10980398 |
| Molecular Formula | C23H23NO |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 4-trityliminobutan-1-ol |
| SMILES | OCCC/C=N/C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H23NO/c25-19-11-10-18-24-23(20-12-4-1-5-13-20,21-14-6-2-7-15-21)22-16-8-3-9-17-22/h1-9,12-18,25H,10-11,19H2/b24-18+ |
| InChIKey | ZFTPJMNIRVLADL-HKOYGPOVSA-N |
| XLogP | 4.82 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 4-trityliminobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-trityliminobutan-1-ol?
The IUPAC name of 4-trityliminobutan-1-ol (CID 10980398) is 4-trityliminobutan-1-ol.
What is the SMILES notation for 4-trityliminobutan-1-ol?
The canonical SMILES for 4-trityliminobutan-1-ol is OCCC/C=N/C(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 4-trityliminobutan-1-ol?
The InChIKey is ZFTPJMNIRVLADL-HKOYGPOVSA-N. The full InChI is InChI=1S/C23H23NO/c25-19-11-10-18-24-23(20-12-4-1-5-13-20,21-14-6-2-7-15-21)22-16-8-3-9-17-22/h1-9,12-18,25H,10-11,19H2/b24-18+.
What are the key properties of 4-trityliminobutan-1-ol?
4-trityliminobutan-1-ol has a molecular weight of 329.44 g/mol, XLogP of 4.82, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-trityliminobutan-1-ol is sourced from PubChem (CID 10980398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).