C22H22N2O — CID 10980431
N,N-dibenzyl-N'-(3-methoxyphenyl)methanimidamide (PubChem CID 10980431) has the molecular formula C22H22N2O and a molecular weight of 330.43 g/mol. Its IUPAC name is N,N-dibenzyl-N'-(3-methoxyphenyl)methanimidamide.
| Compound Name | N,N-dibenzyl-N'-(3-methoxyphenyl)methanimidamide |
|---|---|
| PubChem CID | 10980431 |
| Molecular Formula | C22H22N2O |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | N,N-dibenzyl-N'-(3-methoxyphenyl)methanimidamide |
| SMILES | COc1cccc(/N=C/N(Cc2ccccc2)Cc2ccccc2)c1 |
| InChI | InChI=1S/C22H22N2O/c1-25-22-14-8-13-21(15-22)23-18-24(16-19-9-4-2-5-10-19)17-20-11-6-3-7-12-20/h2-15,18H,16-17H2,1H3/b23-18+ |
| InChIKey | HVGMVXNNPHGRDW-PTGBLXJZSA-N |
| XLogP | 5.06 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|