C21H22N2Si — CID 10980438
trimethyl-(5-methyl-3-phenylpyrido[4,3-b]indol-4-yl)silane (PubChem CID 10980438) has the molecular formula C21H22N2Si and a molecular weight of 330.51 g/mol. Its IUPAC name is trimethyl-(5-methyl-3-phenylpyrido[4,3-b]indol-4-yl)silane.
| Compound Name | trimethyl-(5-methyl-3-phenylpyrido[4,3-b]indol-4-yl)silane |
|---|---|
| PubChem CID | 10980438 |
| Molecular Formula | C21H22N2Si |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | trimethyl-(5-methyl-3-phenylpyrido[4,3-b]indol-4-yl)silane |
| SMILES | Cn1c2ccccc2c2cnc(-c3ccccc3)c([Si](C)(C)C)c21 |
| InChI | InChI=1S/C21H22N2Si/c1-23-18-13-9-8-12-16(18)17-14-22-19(15-10-6-5-7-11-15)21(20(17)23)24(2,3)4/h5-14H,1-4H3 |
| InChIKey | CEWGYWXVZIRCPI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|