About N-benzyl-3-hydroxy-3,3-diphenylpropanamide
N-benzyl-3-hydroxy-3,3-diphenylpropanamide (PubChem CID 10980465) has the molecular formula C22H21NO2
and a molecular weight of 331.42 g/mol. Its IUPAC name is N-benzyl-3-hydroxy-3,3-diphenylpropanamide.
Molecular Properties
| Compound Name | N-benzyl-3-hydroxy-3,3-diphenylpropanamide |
| PubChem CID | 10980465 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | N-benzyl-3-hydroxy-3,3-diphenylpropanamide |
| SMILES | O=C(CC(O)(c1ccccc1)c1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C22H21NO2/c24-21(23-17-18-10-4-1-5-11-18)16-22(25,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,25H,16-17H2,(H,23,24) |
| InChIKey | NRIATCQNRFQKSF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-benzyl-3-hydroxy-3,3-diphenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-3-hydroxy-3,3-diphenylpropanamide?
The IUPAC name of N-benzyl-3-hydroxy-3,3-diphenylpropanamide (CID 10980465) is N-benzyl-3-hydroxy-3,3-diphenylpropanamide.
What is the SMILES notation for N-benzyl-3-hydroxy-3,3-diphenylpropanamide?
The canonical SMILES for N-benzyl-3-hydroxy-3,3-diphenylpropanamide is O=C(CC(O)(c1ccccc1)c1ccccc1)NCc1ccccc1.
What is the InChIKey of N-benzyl-3-hydroxy-3,3-diphenylpropanamide?
The InChIKey is NRIATCQNRFQKSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO2/c24-21(23-17-18-10-4-1-5-11-18)16-22(25,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,25H,16-17H2,(H,23,24).
What are the key properties of N-benzyl-3-hydroxy-3,3-diphenylpropanamide?
N-benzyl-3-hydroxy-3,3-diphenylpropanamide has a molecular weight of 331.42 g/mol, XLogP of 3.63, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-3-hydroxy-3,3-diphenylpropanamide is sourced from PubChem (CID 10980465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).