C18H21ClN2O2 — CID 10980515
3-(4-chlorophenyl)-3-(2-methoxyanilino)-N,N-dimethylpropanamide (PubChem CID 10980515) has the molecular formula C18H21ClN2O2 and a molecular weight of 332.83 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-(2-methoxyanilino)-N,N-dimethylpropanamide.
| Compound Name | 3-(4-chlorophenyl)-3-(2-methoxyanilino)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 10980515 |
| Molecular Formula | C18H21ClN2O2 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 3-(4-chlorophenyl)-3-(2-methoxyanilino)-N,N-dimethylpropanamide |
| SMILES | COc1ccccc1NC(CC(=O)N(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H21ClN2O2/c1-21(2)18(22)12-16(13-8-10-14(19)11-9-13)20-15-6-4-5-7-17(15)23-3/h4-11,16,20H,12H2,1-3H3 |
| InChIKey | CXEZNBNCWWEORC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |