C12H23N3O6S — CID 10980637
4-[[[(2S,3S)-2-amino-3-methylpentanoyl]amino]methylamino]-2-methylsulfonyl-4-oxobutanoic acid (PubChem CID 10980637) has the molecular formula C12H23N3O6S and a molecular weight of 337.40 g/mol. Its IUPAC name is 4-[[[(2S,3S)-2-amino-3-methylpentanoyl]amino]methylamino]-2-methylsulfonyl-4-oxobutanoic acid.
| Compound Name | 4-[[[(2S,3S)-2-amino-3-methylpentanoyl]amino]methylamino]-2-methylsulfonyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 10980637 |
| Molecular Formula | C12H23N3O6S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 4-[[[(2S,3S)-2-amino-3-methylpentanoyl]amino]methylamino]-2-methylsulfonyl-4-oxobutanoic acid |
| SMILES | CC[C@H](C)[C@H](N)C(=O)NCNC(=O)CC(C(=O)O)S(C)(=O)=O |
| InChI | InChI=1S/C12H23N3O6S/c1-4-7(2)10(13)11(17)15-6-14-9(16)5-8(12(18)19)22(3,20)21/h7-8,10H,4-6,13H2,1-3H3,(H,14,16)(H,15,17)(H,18,19)/t7-,8?,10-/m0/s1 |
| InChIKey | ZOHHXIVGMWQWBW-OFQRNFBNSA-N |
| XLogP | -1.56 |
| TPSA | 155.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|