C20H23NO4 — CID 10980763
2-[(4-aminophenoxy)methyl]-6-hydroxy-2,5,7,8-tetramethyl-3H-chromen-4-one (PubChem CID 10980763) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-[(4-aminophenoxy)methyl]-6-hydroxy-2,5,7,8-tetramethyl-3H-chromen-4-one.
| Compound Name | 2-[(4-aminophenoxy)methyl]-6-hydroxy-2,5,7,8-tetramethyl-3H-chromen-4-one |
|---|---|
| PubChem CID | 10980763 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 2-[(4-aminophenoxy)methyl]-6-hydroxy-2,5,7,8-tetramethyl-3H-chromen-4-one |
| SMILES | Cc1c(C)c2c(c(C)c1O)C(=O)CC(C)(COc1ccc(N)cc1)O2 |
| InChI | InChI=1S/C20H23NO4/c1-11-12(2)19-17(13(3)18(11)23)16(22)9-20(4,25-19)10-24-15-7-5-14(21)6-8-15/h5-8,23H,9-10,21H2,1-4H3 |
| InChIKey | QKMRJWQWRVPEHE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|