About S-ethyl (2R,3S)-3-azido-3-phenyl-2-phenylmethoxypropanethioate
S-ethyl (2R,3S)-3-azido-3-phenyl-2-phenylmethoxypropanethioate (PubChem CID 10980771) has the molecular formula C18H19N3O2S
and a molecular weight of 341.44 g/mol. Its IUPAC name is S-ethyl (2R,3S)-3-azido-3-phenyl-2-phenylmethoxypropanethioate.
Molecular Properties
| Compound Name | S-ethyl (2R,3S)-3-azido-3-phenyl-2-phenylmethoxypropanethioate |
| PubChem CID | 10980771 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | S-ethyl (2R,3S)-3-azido-3-phenyl-2-phenylmethoxypropanethioate |
| SMILES | CCSC(=O)[C@H](OCc1ccccc1)[C@@H](N=[N+]=[N-])c1ccccc1 |
| InChI | InChI=1S/C18H19N3O2S/c1-2-24-18(22)17(23-13-14-9-5-3-6-10-14)16(20-21-19)15-11-7-4-8-12-15/h3-12,16-17H,2,13H2,1H3/t16-,17+/m0/s1 |
| InChIKey | ZMFGVHBXOYPECD-DLBZAZTESA-N |
| XLogP | 4.90 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-ethyl (2R,3S)-3-azido-3-phenyl-2-phenylmethoxypropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethyl (2R,3S)-3-azido-3-phenyl-2-phenylmethoxypropanethioate?
The IUPAC name of S-ethyl (2R,3S)-3-azido-3-phenyl-2-phenylmethoxypropanethioate (CID 10980771) is S-ethyl (2R,3S)-3-azido-3-phenyl-2-phenylmethoxypropanethioate.
What is the SMILES notation for S-ethyl (2R,3S)-3-azido-3-phenyl-2-phenylmethoxypropanethioate?
The canonical SMILES for S-ethyl (2R,3S)-3-azido-3-phenyl-2-phenylmethoxypropanethioate is CCSC(=O)[C@H](OCc1ccccc1)[C@@H](N=[N+]=[N-])c1ccccc1.
What is the InChIKey of S-ethyl (2R,3S)-3-azido-3-phenyl-2-phenylmethoxypropanethioate?
The InChIKey is ZMFGVHBXOYPECD-DLBZAZTESA-N. The full InChI is InChI=1S/C18H19N3O2S/c1-2-24-18(22)17(23-13-14-9-5-3-6-10-14)16(20-21-19)15-11-7-4-8-12-15/h3-12,16-17H,2,13H2,1H3/t16-,17+/m0/s1.
What are the key properties of S-ethyl (2R,3S)-3-azido-3-phenyl-2-phenylmethoxypropanethioate?
S-ethyl (2R,3S)-3-azido-3-phenyl-2-phenylmethoxypropanethioate has a molecular weight of 341.44 g/mol, XLogP of 4.90, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethyl (2R,3S)-3-azido-3-phenyl-2-phenylmethoxypropanethioate is sourced from PubChem (CID 10980771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).