About 3-ethyl-1-hydroxy-6,8-dimethoxy-9-oxo-10H-anthracene-2-carboxylic acid
3-ethyl-1-hydroxy-6,8-dimethoxy-9-oxo-10H-anthracene-2-carboxylic acid (PubChem CID 10980786) has the molecular formula C19H18O6
and a molecular weight of 342.35 g/mol. Its IUPAC name is 3-ethyl-1-hydroxy-6,8-dimethoxy-9-oxo-10H-anthracene-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-ethyl-1-hydroxy-6,8-dimethoxy-9-oxo-10H-anthracene-2-carboxylic acid |
| PubChem CID | 10980786 |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 3-ethyl-1-hydroxy-6,8-dimethoxy-9-oxo-10H-anthracene-2-carboxylic acid |
| SMILES | CCc1cc2c(c(O)c1C(=O)O)C(=O)c1c(cc(OC)cc1OC)C2 |
| InChI | InChI=1S/C19H18O6/c1-4-9-5-10-6-11-7-12(24-2)8-13(25-3)14(11)17(20)15(10)18(21)16(9)19(22)23/h5,7-8,21H,4,6H2,1-3H3,(H,22,23) |
| InChIKey | DNRLXGUJHWGYPZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-ethyl-1-hydroxy-6,8-dimethoxy-9-oxo-10H-anthracene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-hydroxy-6,8-dimethoxy-9-oxo-10H-anthracene-2-carboxylic acid?
The IUPAC name of 3-ethyl-1-hydroxy-6,8-dimethoxy-9-oxo-10H-anthracene-2-carboxylic acid (CID 10980786) is 3-ethyl-1-hydroxy-6,8-dimethoxy-9-oxo-10H-anthracene-2-carboxylic acid.
What is the SMILES notation for 3-ethyl-1-hydroxy-6,8-dimethoxy-9-oxo-10H-anthracene-2-carboxylic acid?
The canonical SMILES for 3-ethyl-1-hydroxy-6,8-dimethoxy-9-oxo-10H-anthracene-2-carboxylic acid is CCc1cc2c(c(O)c1C(=O)O)C(=O)c1c(cc(OC)cc1OC)C2.
What is the InChIKey of 3-ethyl-1-hydroxy-6,8-dimethoxy-9-oxo-10H-anthracene-2-carboxylic acid?
The InChIKey is DNRLXGUJHWGYPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18O6/c1-4-9-5-10-6-11-7-12(24-2)8-13(25-3)14(11)17(20)15(10)18(21)16(9)19(22)23/h5,7-8,21H,4,6H2,1-3H3,(H,22,23).
What are the key properties of 3-ethyl-1-hydroxy-6,8-dimethoxy-9-oxo-10H-anthracene-2-carboxylic acid?
3-ethyl-1-hydroxy-6,8-dimethoxy-9-oxo-10H-anthracene-2-carboxylic acid has a molecular weight of 342.35 g/mol, XLogP of 2.81, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-hydroxy-6,8-dimethoxy-9-oxo-10H-anthracene-2-carboxylic acid is sourced from PubChem (CID 10980786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).