About diphenyl-[5-(2,2,2-trifluoroethoxy)cyclopenten-1-yl]methanol
diphenyl-[5-(2,2,2-trifluoroethoxy)cyclopenten-1-yl]methanol (PubChem CID 10980949) has the molecular formula C20H19F3O2
and a molecular weight of 348.36 g/mol. Its IUPAC name is diphenyl-[5-(2,2,2-trifluoroethoxy)cyclopenten-1-yl]methanol.
Molecular Properties
| Compound Name | diphenyl-[5-(2,2,2-trifluoroethoxy)cyclopenten-1-yl]methanol |
| PubChem CID | 10980949 |
| Molecular Formula | C20H19F3O2 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | diphenyl-[5-(2,2,2-trifluoroethoxy)cyclopenten-1-yl]methanol |
| SMILES | OC(C1=CCCC1OCC(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H19F3O2/c21-19(22,23)14-25-18-13-7-12-17(18)20(24,15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-6,8-12,18,24H,7,13-14H2 |
| InChIKey | HQVYRJADMYMOJV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze diphenyl-[5-(2,2,2-trifluoroethoxy)cyclopenten-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl-[5-(2,2,2-trifluoroethoxy)cyclopenten-1-yl]methanol?
The IUPAC name of diphenyl-[5-(2,2,2-trifluoroethoxy)cyclopenten-1-yl]methanol (CID 10980949) is diphenyl-[5-(2,2,2-trifluoroethoxy)cyclopenten-1-yl]methanol.
What is the SMILES notation for diphenyl-[5-(2,2,2-trifluoroethoxy)cyclopenten-1-yl]methanol?
The canonical SMILES for diphenyl-[5-(2,2,2-trifluoroethoxy)cyclopenten-1-yl]methanol is OC(C1=CCCC1OCC(F)(F)F)(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenyl-[5-(2,2,2-trifluoroethoxy)cyclopenten-1-yl]methanol?
The InChIKey is HQVYRJADMYMOJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19F3O2/c21-19(22,23)14-25-18-13-7-12-17(18)20(24,15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-6,8-12,18,24H,7,13-14H2.
What are the key properties of diphenyl-[5-(2,2,2-trifluoroethoxy)cyclopenten-1-yl]methanol?
diphenyl-[5-(2,2,2-trifluoroethoxy)cyclopenten-1-yl]methanol has a molecular weight of 348.36 g/mol, XLogP of 4.59, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl-[5-(2,2,2-trifluoroethoxy)cyclopenten-1-yl]methanol is sourced from PubChem (CID 10980949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).