C21H32O4 — CID 10980969
(4S,5S)-4-[(1R,2R)-2-formylcyclohexyl]-2,2,6,6,8-pentamethyl-1,3-dioxaspiro[4.5]dec-7-ene-7-carbaldehyde (PubChem CID 10980969) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is (4S,5S)-4-[(1R,2R)-2-formylcyclohexyl]-2,2,6,6,8-pentamethyl-1,3-dioxaspiro[4.5]dec-7-ene-7-carbaldehyde.
| Compound Name | (4S,5S)-4-[(1R,2R)-2-formylcyclohexyl]-2,2,6,6,8-pentamethyl-1,3-dioxaspiro[4.5]dec-7-ene-7-carbaldehyde |
|---|---|
| PubChem CID | 10980969 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (4S,5S)-4-[(1R,2R)-2-formylcyclohexyl]-2,2,6,6,8-pentamethyl-1,3-dioxaspiro[4.5]dec-7-ene-7-carbaldehyde |
| SMILES | CC1=C(C=O)C(C)(C)[C@]2(CC1)OC(C)(C)O[C@H]2[C@@H]1CCCC[C@H]1C=O |
| InChI | InChI=1S/C21H32O4/c1-14-10-11-21(19(2,3)17(14)13-23)18(24-20(4,5)25-21)16-9-7-6-8-15(16)12-22/h12-13,15-16,18H,6-11H2,1-5H3/t15-,16+,18-,21+/m0/s1 |
| InChIKey | OEWMOBBCXJSCCV-ONFYXGJMSA-N |
| XLogP | 4.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|