C18H25NO6 — CID 10981038
8-O-tert-butyl 2-O-[(2S)-1-ethoxy-1-oxopropan-2-yl] (1R,5R)-8-azabicyclo[3.2.1]octa-2,6-diene-2,8-dicarboxylate (PubChem CID 10981038) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is 8-O-tert-butyl 2-O-[(2S)-1-ethoxy-1-oxopropan-2-yl] (1R,5R)-8-azabicyclo[3.2.1]octa-2,6-diene-2,8-dicarboxylate.
| Compound Name | 8-O-tert-butyl 2-O-[(2S)-1-ethoxy-1-oxopropan-2-yl] (1R,5R)-8-azabicyclo[3.2.1]octa-2,6-diene-2,8-dicarboxylate |
|---|---|
| PubChem CID | 10981038 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 8-O-tert-butyl 2-O-[(2S)-1-ethoxy-1-oxopropan-2-yl] (1R,5R)-8-azabicyclo[3.2.1]octa-2,6-diene-2,8-dicarboxylate |
| SMILES | CCOC(=O)[C@H](C)OC(=O)C1=CC[C@@H]2C=C[C@H]1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H25NO6/c1-6-23-15(20)11(2)24-16(21)13-9-7-12-8-10-14(13)19(12)17(22)25-18(3,4)5/h8-12,14H,6-7H2,1-5H3/t11-,12+,14+/m0/s1 |
| InChIKey | WEEXRRFYXDHINJ-OUCADQQQSA-N |
| XLogP | 2.36 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|