C12H10Br2O3 — CID 10981299
(1'S,2'R,6'S,7'S)-4',7'-dibromospiro[1,3-dioxolane-2,10'-tricyclo[5.2.1.02,6]deca-4,8-diene]-3'-one (PubChem CID 10981299) has the molecular formula C12H10Br2O3 and a molecular weight of 362.02 g/mol. Its IUPAC name is (1'S,2'R,6'S,7'S)-4',7'-dibromospiro[1,3-dioxolane-2,10'-tricyclo[5.2.1.02,6]deca-4,8-diene]-3'-one.
| Compound Name | (1'S,2'R,6'S,7'S)-4',7'-dibromospiro[1,3-dioxolane-2,10'-tricyclo[5.2.1.02,6]deca-4,8-diene]-3'-one |
|---|---|
| PubChem CID | 10981299 |
| Molecular Formula | C12H10Br2O3 |
| Molecular Weight | 362.02 g/mol |
| Exact Mass | 359.90 |
| IUPAC Name | (1'S,2'R,6'S,7'S)-4',7'-dibromospiro[1,3-dioxolane-2,10'-tricyclo[5.2.1.02,6]deca-4,8-diene]-3'-one |
| SMILES | O=C1C(Br)=C[C@@H]2[C@H]1[C@@H]1C=C[C@@]2(Br)C12OCCO2 |
| InChI | InChI=1S/C12H10Br2O3/c13-8-5-7-9(10(8)15)6-1-2-11(7,14)12(6)16-3-4-17-12/h1-2,5-7,9H,3-4H2/t6-,7+,9+,11-/m0/s1 |
| InChIKey | CWLJXBQYHGTEDC-QJSROADHSA-N |
| XLogP | 2.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.02 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|