C20H18N4OS — CID 10981316
12-benzyl-4-thiophen-2-yl-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one (PubChem CID 10981316) has the molecular formula C20H18N4OS and a molecular weight of 362.46 g/mol. Its IUPAC name is 12-benzyl-4-thiophen-2-yl-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one.
| Compound Name | 12-benzyl-4-thiophen-2-yl-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one |
|---|---|
| PubChem CID | 10981316 |
| Molecular Formula | C20H18N4OS |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 12-benzyl-4-thiophen-2-yl-3,6,8,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4-trien-7-one |
| SMILES | O=c1[nH]c2c(c3nc(-c4cccs4)cn13)CN(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C20H18N4OS/c25-20-22-16-8-9-23(11-14-5-2-1-3-6-14)12-15(16)19-21-17(13-24(19)20)18-7-4-10-26-18/h1-7,10,13H,8-9,11-12H2,(H,22,25) |
| InChIKey | QAXYGVUMRWGFSV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |