C19H28O7 — CID 10981453
[(3R,3aR,4S,4aS,5R,8R,8aR,9aS)-4-acetyloxy-5-hydroxy-3,5,8a-trimethyl-2-oxo-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-8-yl] acetate (PubChem CID 10981453) has the molecular formula C19H28O7 and a molecular weight of 368.43 g/mol. Its IUPAC name is [(3R,3aR,4S,4aS,5R,8R,8aR,9aS)-4-acetyloxy-5-hydroxy-3,5,8a-trimethyl-2-oxo-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-8-yl] acetate.
| Compound Name | [(3R,3aR,4S,4aS,5R,8R,8aR,9aS)-4-acetyloxy-5-hydroxy-3,5,8a-trimethyl-2-oxo-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-8-yl] acetate |
|---|---|
| PubChem CID | 10981453 |
| Molecular Formula | C19H28O7 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | [(3R,3aR,4S,4aS,5R,8R,8aR,9aS)-4-acetyloxy-5-hydroxy-3,5,8a-trimethyl-2-oxo-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-8-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H]2[C@H](C[C@]3(C)[C@@H]1[C@](C)(O)CC[C@H]3OC(C)=O)OC(=O)[C@@H]2C |
| InChI | InChI=1S/C19H28O7/c1-9-14-12(26-17(9)22)8-18(4)13(24-10(2)20)6-7-19(5,23)16(18)15(14)25-11(3)21/h9,12-16,23H,6-8H2,1-5H3/t9-,12+,13-,14-,15+,16-,18+,19-/m1/s1 |
| InChIKey | CHXBAJUNSJHCKJ-DUARXBGSSA-N |
| XLogP | 1.60 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|