C19H27N3O3Si — CID 10981609
benzotriazol-1-yl-[(2R,3S,4S)-3-methyl-4-triethylsilyloxy-3,4-dihydro-2H-pyran-2-yl]methanone (PubChem CID 10981609) has the molecular formula C19H27N3O3Si and a molecular weight of 373.53 g/mol. Its IUPAC name is benzotriazol-1-yl-[(2R,3S,4S)-3-methyl-4-triethylsilyloxy-3,4-dihydro-2H-pyran-2-yl]methanone.
| Compound Name | benzotriazol-1-yl-[(2R,3S,4S)-3-methyl-4-triethylsilyloxy-3,4-dihydro-2H-pyran-2-yl]methanone |
|---|---|
| PubChem CID | 10981609 |
| Molecular Formula | C19H27N3O3Si |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | benzotriazol-1-yl-[(2R,3S,4S)-3-methyl-4-triethylsilyloxy-3,4-dihydro-2H-pyran-2-yl]methanone |
| SMILES | CC[Si](CC)(CC)O[C@H]1C=CO[C@@H](C(=O)n2nnc3ccccc32)[C@@H]1C |
| InChI | InChI=1S/C19H27N3O3Si/c1-5-26(6-2,7-3)25-17-12-13-24-18(14(17)4)19(23)22-16-11-9-8-10-15(16)20-21-22/h8-14,17-18H,5-7H2,1-4H3/t14-,17+,18-/m1/s1 |
| InChIKey | LMZFOIKSQPJJRK-FHLIZLRMSA-N |
| XLogP | 4.01 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|