C20H26O7 — CID 10981737
(2S)-2-phenylmethoxy-2-[(1S,2R,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetaldehyde (PubChem CID 10981737) has the molecular formula C20H26O7 and a molecular weight of 378.42 g/mol. Its IUPAC name is (2S)-2-phenylmethoxy-2-[(1S,2R,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetaldehyde.
| Compound Name | (2S)-2-phenylmethoxy-2-[(1S,2R,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetaldehyde |
|---|---|
| PubChem CID | 10981737 |
| Molecular Formula | C20H26O7 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (2S)-2-phenylmethoxy-2-[(1S,2R,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetaldehyde |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H]1OC(C)(C)O[C@H]1O[C@@H]2[C@@H](C=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H26O7/c1-19(2)24-15-14(13(10-21)22-11-12-8-6-5-7-9-12)23-18-17(16(15)25-19)26-20(3,4)27-18/h5-10,13-18H,11H2,1-4H3/t13-,14-,15+,16+,17-,18-/m1/s1 |
| InChIKey | VRYNPDPTEBKTRR-GVLSGGHMSA-N |
| XLogP | 2.17 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|